CAS:101-90-6 | Resorcinol diglycidyl ether
Synonyms:
resorcinolbis(2,3-epoxypropyl)ether;resorcinolglycidylether;Resorcinyl diglycidyl ether;resorcinyldiglycidylether;RESORCINOL DIGLYCIDYL ETHER;m-Bis(2,3-epoxypropoxy)benzene;DIGLYCIDYL RESORCINOL ETHER;1,3-BIS(GLYCIDYLOXY) BENZENE
Canonical SMILES: C1C(O1)COC2=CC(=CC=C2)OCC3CO3
HS Code: 29109000
Density:1.21 g/mL at25 °C(lit.)
Boiling Point:172 °C(lit.)
Refractive Index:n20/D1.542(lit.)
Flash Point: >230 °F
Melting Point: 33-35°C
Hazard Codes: Xn
Risk Statements: 21/22-36/38-40-43-52/53-68
Safety Statements: 23-36/37-61
Transport: 2811
WGK Germany: 2
HazardClass: 6.1
Write your message here and send it to us