CAS:57-66-9 | Probenecid
Synonyms:
robenecid;Synergid R;synergidr;Tubophan;Uricosid;LABOTEST-BB LT00772250;AKOS BBS-00002773;4-(DI-N-PROPYLAMINO)SULFONYL BENZOIC ACID
Canonical SMILES: CCCN(CCC)S(=O)(=O)C1=CC=C(C=C1)C(=O)O
HS Code: 29350090
Density:1.2483(roughestimate)
Boiling Point:438.0±47.0°C(Predicted)
Refractive Index:1.6800(estimate)
Melting Point: 194-196°C
Storage: StoreatRT
PKA: 5.8(at25℃)
Appearance: neat
Hazard Codes: Xn
Risk Statements: 22-40
Safety Statements: 36/37-24/25
Transport: 3249
WGK Germany: 3
Write your message here and send it to us