CAS:2251-50-5 |Pentafluorobenzoyl chloride
Synonyms:
pentafluorobenzoychloride;Pentafluorobenzoyl chloride 99%;Pentafluorobenzoylchloride99%;Pentafluorobenzoic acid chloride, Perfluorobenzoyl chloride;2,3,4,5,6-Pentafluorobenzoic acid chloride;Pentafluorobenzoyl chloride,98%;Pentafluorobenzoyl c;Pentafluorobenzoyl chloride, 98% 5GR
Canonical SMILES: C1(=C(C(=C(C(=C1F)F)F)F)F)C(=O)Cl
HS Code: 29163900
Density:1.601 g/mL at25 °C(lit.)
Boiling Point:158-159 °C(lit.)
Refractive Index:n20/D1.453(lit.)
Flash Point: None
Storage: 2-8°C
Appearance: Liquid
Hazard Codes: C
Risk Statements: 14-34
Safety Statements: 26-36/37/39-45
Transport: UN 3265 8/PG 2
WGK Germany: 3
HazardClass: 8
Write your message here and send it to us