Mono-methyl isophthalate
Synonyms:
METHYL HYDROGEN ISOPHTHALATE;METHYL M-PHTHALATE;IFLAB-BB F2108-0140;isophthalic acid methyl ester;3-METHOXYCARBONYL BENZOIC ACID;RARECHEM AL BE 0627;MONO-METHYL ISOPHTHALATE;Benzene-1,3-dicarboxylic acid monomethyl ester~Isophthalic acid monomethyl ester~Monomethyl isophthalate
Canonical SMILES: COC(=O)C1=CC=CC(=C1)C(=O)O
HS Code: 29163990
Density:1.288±0.06g/cm3(Predicted)
Boiling Point:339.3±25.0°C(Predicted)
Melting Point: 194-196 °C(lit.)
PKA: 3.83±0.10(Predicted)
Appearance: CrystallinePowder
Hazard Codes: Xi
Risk Statements: 36/37/38
Safety Statements: 26-36
WGK Germany: 3
HazardClass: IRRITANT
Write your message here and send it to us