CAS:482-89-3 |Indigo
Synonyms:
blueno.201;blueno201;C.I, vat blue 1;C.I. pigment blue 66;C.I.Vatblue1;cipigmentblue66;civatblue1;Cystoceva
Canonical SMILES: C1=CC=C2C(=C1)C(=O)C(=C3C(=O)C4=CC=CC=C4N3)N2
HS Code: 32041510
Density:1.01 g/mL at20 °C
Boiling Point:405.51°C(roughestimate)
Refractive Index:1.5800(estimate)
Flash Point: >220℃
Melting Point: >300 °C(lit.)
PKA: -3.83±0.20(Predicted)
Appearance: Powder
Hazard Codes: Xi,Xn
Risk Statements: 36/38-36/37/38-48/20/21/22
Safety Statements: 26-36
Transport: UN 3264 8/PG 3
WGK Germany: 1
Write your message here and send it to us