CAS:77182-82-2 | Glufosinate-ammonium
Synonyms:
DL-Phosphinothricin ammonium salt;FREE SAMPLE NCV GLUFOSINATE AMMONIUM;77182-82-2 supplier,Glufosinate-ammonium;dl-phosphinothricinammonium;finale;finale14sl;hoe00661;hoe39866
Canonical SMILES: CP(=O)(CCC(C(=O)[O-])N)O.[NH4+]
HS Code: 29319019
Density:1.4g/cm3
Boiling Point:519℃
Flash Point: 100 °C
Melting Point: 210°C
Storage: 0-6°C
Appearance: neat
Hazard Codes: Xn,T
Risk Statements: 22-48/20/22-20/21/22-63-60
Safety Statements: 53-45-24/25
Transport: 2588
WGK Germany: 1
HazardClass: 6.1(b)
Write your message here and send it to us