CAS:149-91-7 | Gallic acid
Synonyms:
Gallic acid 149-91-7 3,4,5-Trihydroxybenzoic acid;3,4,5-Trihydroxybenzoic acid 149-91-7 Gallic acid;Gallic acid 149-91-7;TIMTEC-BB SBB008781;RARECHEM AL BE 0070;3,4,5-trihydroxy-benzoicaci;gallic;Gallussaure
Canonical SMILES: C1=C(C=C(C(=C1O)O)O)C(=O)O
HS Code: 29182900
Density:1.694
Boiling Point:259.73°C(roughestimate)
Refractive Index:1.5690(estimate)
Melting Point: 252 °C(dec.)(lit.)
Storage: Storebelow+30°C.
PKA: 4.41(at25℃)
Appearance: Powder
Hazard Codes: Xi
Risk Statements: 36/37/38
Safety Statements: 26-36-24/25-37/39
WGK Germany: 2
Write your message here and send it to us