CAS:5122-95-2 | Biphenyl-3-boronic acid
Synonyms:
CHEMBRDG-BB 3201028;BIPHENYL-3-BORONIC ACID;(1,1'-BIPHENYL-3-YL)BORONIC ACID;3-BIPHENYLBORONIC ACID;AKOS BRN-0056;RARECHEM AH PB 0085;3-Biphenylboronic Acid (contains varying amounts of Anhydride);Biphenyl-3-boronic acid,98%
Canonical SMILES: B(C1=CC(=CC=C1)C2=CC=CC=C2)(O)O
HS Code: 29163990
Density:1.18±0.1g/cm3(Predicted)
Boiling Point:411.0±38.0°C(Predicted)
Melting Point: 193-198 °C(lit.)
Storage: 0-6°C
PKA: 8.30±0.10(Predicted)
Appearance: solid
Hazard Codes: Xi,C
Risk Statements: 36/37/38
Safety Statements: 37/39-26
WGK Germany: 3
Write your message here and send it to us