CAS:18704-37-5 | 8-Quinolinesulfonyl chloride
Synonyms:
Quinoline-8-sulfonyl chloride
Canonical SMILES: C1=CC2=C(C(=C1)S(=O)(=O)Cl)N=CC=C2
HS Code: 29334990
Density:1.483±0.06g/cm3(Predicted)
Boiling Point:306°C
Flash Point: 306°C
Melting Point: 126-129 °C(lit.)
Storage: 2-8°C
PKA: 0?+-.0.17(Predicted)
Hazard Codes: C
Risk Statements: 34
Safety Statements: 26-36/37/39-45-27
Transport: UN 3261 8/PG 2
WGK Germany: 3
HazardClass: 8
Write your message here and send it to us