CAS:1679-18-1 | 4-Chlorophenylboronic acid
Synonyms:
4-Chlorophenylbronic Acid;4-Chlorophenylboronic acid 95%;The effects of boric acid;AC 34441;Benzeneboronic acid, p-chloro-;WLN: QBQR DG;B-(4-Chlorophenyl)boronic acid;BORONIC ACID, (4-CHLOROPHENYL)-
Canonical SMILES: B(C1=CC=C(C=C1)Cl)(O)O
HS Code: 29319090
Density:1.32±0.1g/cm3(Predicted)
Boiling Point:295.4±42.0°C(Predicted)
Melting Point: 284-289 °C(lit.)
Storage: Refrigerator(+4°C)
PKA: 8.39±0.10(Predicted)
Appearance: CrystallinePowder
Hazard Codes: Xn,Xi
Risk Statements: 20/21/22-36/37/38
Safety Statements: 36-37/39-26
WGK Germany: 3
HazardClass: IRRITANT
Write your message here and send it to us