CAS:183065-68-1 | 4-Bromo-2,6-difluorobenzoic acid
Synonyms:
RARECHEM AL BE 1306;SALOR-INT L446564-1EA;4-BROMO-2,6-DIFLUOROBENZOIC ACID;BENZOIC ACID, 4-BROMO-2,6-DIFLUORO-;4- broMo-2,6- twofluoro benzoic acid;4-Bromo-2,6-difluorobenzoic acid, >=98%
Canonical SMILES: C1=C(C=C(C(=C1F)C(=O)O)F)Br
HS Code: 29163100
Density:1.872±0.06g/cm3(Predicted)
Boiling Point:271.7±40.0°C(Predicted)
Melting Point: 201-203°C
Storage: Roomtemperature.
PKA: 2.11±0.10(Predicted)
Hazard Codes: Xi,Xn
Risk Statements: 22-36/37/38
Safety Statements: 26-37
WGK Germany: 3
HazardClass: IRRITANT
Write your message here and send it to us