CAS:5122-94-1 | 4-Biphenylboronic acid
Synonyms:
4-Biphenylboronic Acid (contains varying amounts of Anhydride);Biphenyl-4-boronic acid, 98+%;4-Biphenylboronic ac;4-Biphenylboronic Acid Biphenyl-4-ylboronic acid;(1,1'-Biphenyl)-4-boronic acid;4-Diphenylboronic acid;4-Boronobiphenyl
Canonical SMILES: B(C1=CC=C(C=C1)C2=CC=CC=C2)(O)O
HS Code: 29310095
Density:1.18±0.1g/cm3(Predicted)
Boiling Point:385.5±35.0°C(Predicted)
Melting Point: 232-245 °C(lit.)
PKA: 8.61±0.10(Predicted)
Appearance: Powder
Hazard Codes: Xi,Xn
Risk Statements: 36/37/38-20/21/22
Safety Statements: 26-37/39-36-24/25
WGK Germany: 3
HazardClass: IRRITANT
Write your message here and send it to us