CAS:618-58-6 | 3,5-Dibromobenzoic acid
Synonyms:
3,5-dibromo-benzoicaci;Benzoic acid, 3,5-dibromo-;RARECHEM AL BO 0773;3,5-DIBROMOBENZOIC ACID;BUTTPARK 9957-19;3,5-DibroMobenzoic Acid, 97+%
Canonical SMILES: C1=C(C=C(C=C1Br)Br)C(=O)O
HS Code: 29163990
Density:1.9661(roughestimate)
Boiling Point:355.2±32.0°C(Predicted)
Refractive Index:1.4970(estimate)
Melting Point: 218-220 °C(lit.)
PKA: 3.42±0.10(Predicted)
Hazard Codes: Xi
Risk Statements: 36/37/38
Safety Statements: 26-37/39
WGK Germany: 3
HazardClass: IRRITANT
Write your message here and send it to us