CAS:121602-93-5 | 3,4,5-Trifluorobenzoic acid
Synonyms:
BUTTPARK 30 1-46;RARECHEM AL BO 0682;3,4,5-Trifluorobenzoic acid radical ion
Canonical SMILES: C1=C(C=C(C(=C1F)F)F)C(=O)O
HS Code: 29163990
Density:1,12g/cm
Boiling Point:116-118C/100Torr
Refractive Index:1,471-1,473
Melting Point: 97-99 °C(lit.)
PKA: 3.46±0.10(Predicted)
Hazard Codes: Xi
Risk Statements: 36/37/38
Safety Statements: 26-37/39-36
WGK Germany: 3
HazardClass: IRRITANT
Write your message here and send it to us