CAS:133-32-4 | 3-Indolebutyric acid
Synonyms:
4-(3-1H-Indolyl)butyric acid; 4-(3-Indolyl)butyric acid ; Indole-3-butyric acid; Hormodin; Seradix
Canonical SMILES: C1=CC=C2C(=C1)C(=CN2)CCCC(=O)O
HS Code: 29339990
Density:1.1255(roughestimate)
Boiling Point:341.55°C(roughestimate)
Refractive Index:1.5440(estimate)
Melting Point: 124-125.5 °C(lit.)
Storage: 2-8°C
PKA: 4.83±0.10(Predicted)
Appearance: Liquid
Hazard Codes: T,Xi
Risk Statements: 25-36/37/38
Safety Statements: 26-36-45-38-36/37/39-28A
Transport: UN 2811 6.1/PG 3
WGK Germany: 3
HazardClass: 6.1
Write your message here and send it to us