CAS:19719-28-9 | 2,4-Dichlorophenylacetic acid
Synonyms:
2,4-dcaa acid spike mix;2,4-dichlorophenylacetic acid solution;2,4-Dichlorophenylacetic acid (DCAA);2,4-Diclorophenyl acetic acid;15) 2,4 DICHLORO PHENYL ACETIC ACID;2-(2,4-dichlorophenyl)acetic acid;2,4-Dichlorophenylacetic acid, 98+%;2,4-Dichlorobenzeneacetic acid
Canonical SMILES: C1=CC(=C(C=C1Cl)Cl)CC(=O)O
HS Code: 29163990
Density:1.3806(roughestimate)
Boiling Point:294.45°C(roughestimate)
Refractive Index:1.5490(estimate)
Melting Point: 129-131 °C(lit.)
Storage: 2-8°C
PKA: 3.92±0.10(Predicted)
Appearance: CrystallinePowder
Hazard Codes: Xi
Risk Statements: 36/37/38-67
Safety Statements: 26-36-37/39
WGK Germany: 3
Write your message here and send it to us