CAS:2905-60-4 |2,3-Dichlorobenzoyl chloride
Synonyms:
2,3-Dichlorobenzoic acid chloride;Dichlorobenzoyl chlorid;2,3- twochloro benzoyl chloride;2,3-DICHLOROBENZOYL CHLORIDE;2,3-DICHLOROBENZOYL;Benzoyl chloride, 2,3-dichloro- (6CI,7CI,8CI,9CI);2,3-Dichlorbenzoylchlorid
Canonical SMILES: C1=CC(=C(C(=C1)Cl)Cl)C(=O)Cl
HS Code: 29163990
Density:1.498±0.06g/cm3(Predicted)
Boiling Point:140°C14mm
Flash Point: 167°C
Melting Point: 30-32°C
Hazard Codes: C,Xn
Risk Statements: 34-22
Safety Statements: 26-36/37/39-45
Transport: 3261
WGK Germany: 1
HazardClass: 8
Write your message here and send it to us