CAS:18297-63-7 | 1,3-Bis(trimethylsilyl)urea
Synonyms:
Urea, TMS;N,N'-BIS(TRIMETHYLSILYL)UREA;BIS(TRIMETHYLSILYL)UREA;BSU;N N'-BIS(TRIMETHYLSILYL)UREA 98+%;Hexamethyl disilaurea;Bis(trimethylsilyl) derivative of Urea;n,n’-bis(trimethylsilyl)-ure
Canonical SMILES: C[Si](C)(C)NC(=O)N[Si](C)(C)C
HS Code: 29310095
Density:0.887
Boiling Point:222°C
Flash Point: 65°C
Melting Point: 219-221 °C(lit.)
Storage: 2-8°C
PKA: 16.51±0.46(Predicted)
Appearance: solid
Hazard Codes: F,Xn
Risk Statements: 11-36/37/38-20/21/22
Safety Statements: 14-16-24/25-36-26
Transport: UN 1325 4.1/PG 2
WGK Germany: 3
Write your message here and send it to us