CAS:13922-41-3 | 1-Naphthylboronic acid
Synonyms:
1-NAPTHALENE BORONIC ACID;1-Naphthaleneboronic Acid (contains varying amounts of Anhydride);1-Naphthylboronic acid, min. 97%;(1-Naphthyl)boranediol;(1-Naphthyl)boranic acid;(1-Naphthyl)dihydroxyborane;1-(Dihydroxyboryl)naphthalene;1-Naphthylboranic acid
Canonical SMILES: B(C1=CC=CC2=CC=CC=C12)(O)O
HS Code: 29319090
Density:1.21±0.1g/cm3(Predicted)
Boiling Point:381.9±25.0°C(Predicted)
Melting Point: 208-214 °C(lit.)
Storage: 0-6°C
PKA: 8.53±0.30(Predicted)
Appearance: Powder
Hazard Codes: Xi
Risk Statements: 36/37/38
Safety Statements: 26-36-37/39
WGK Germany: 3
HazardClass: IRRITANT
Write your message here and send it to us